C11H10F11IO2 — CID 153324195
ethyl 4,5,5,6,6,7,7,7-octafluoro-2-iodo-2-methyl-3-(trifluoromethyl)heptanoate (PubChem CID 153324195) has the molecular formula C11H10F11IO2 and a molecular weight of 510.08 g/mol. Its IUPAC name is ethyl 4,5,5,6,6,7,7,7-octafluoro-2-iodo-2-methyl-3-(trifluoromethyl)heptanoate.
| Compound Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-iodo-2-methyl-3-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 153324195 |
| Molecular Formula | C11H10F11IO2 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | ethyl 4,5,5,6,6,7,7,7-octafluoro-2-iodo-2-methyl-3-(trifluoromethyl)heptanoate |
| SMILES | CCOC(=O)C(C)(I)C(C(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F11IO2/c1-3-25-6(24)7(2,23)4(9(15,16)17)5(12)8(13,14)10(18,19)11(20,21)22/h4-5H,3H2,1-2H3 |
| InChIKey | CMRHQGSGVQPDPT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|