C11H8F13IO2 — CID 19082566
ethyl 2,5,5,6,6,7,7,8,8,8-decafluoro-4-iodo-2-(trifluoromethyl)octanoate (PubChem CID 19082566) has the molecular formula C11H8F13IO2 and a molecular weight of 546.06 g/mol. Its IUPAC name is ethyl 2,5,5,6,6,7,7,8,8,8-decafluoro-4-iodo-2-(trifluoromethyl)octanoate.
| Compound Name | ethyl 2,5,5,6,6,7,7,8,8,8-decafluoro-4-iodo-2-(trifluoromethyl)octanoate |
|---|---|
| PubChem CID | 19082566 |
| Molecular Formula | C11H8F13IO2 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.94 |
| IUPAC Name | ethyl 2,5,5,6,6,7,7,8,8,8-decafluoro-4-iodo-2-(trifluoromethyl)octanoate |
| SMILES | CCOC(=O)C(F)(CC(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F13IO2/c1-2-27-5(26)6(12,10(19,20)21)3-4(25)7(13,14)8(15,16)9(17,18)11(22,23)24/h4H,2-3H2,1H3 |
| InChIKey | SLYSVCWUEWMILC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|