C9HF20N — CID 90982918
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)hexan-1-amine (PubChem CID 90982918) has the molecular formula C9HF20N and a molecular weight of 503.07 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)hexan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)hexan-1-amine |
|---|---|
| PubChem CID | 90982918 |
| Molecular Formula | C9HF20N |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-(1,1,2,2,3,3,3-heptafluoropropyl)hexan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF20N/c10-1(11,3(14,15)6(20,21)22)2(12,13)4(16,17)8(26,27)30-9(28,29)5(18,19)7(23,24)25/h30H |
| InChIKey | ATEBCPSBTSJVHB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|