C8H2F17NO — CID 87846440
1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-7-(trifluoromethylamino)heptan-1-ol (PubChem CID 87846440) has the molecular formula C8H2F17NO and a molecular weight of 451.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-7-(trifluoromethylamino)heptan-1-ol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-7-(trifluoromethylamino)heptan-1-ol |
|---|---|
| PubChem CID | 87846440 |
| Molecular Formula | C8H2F17NO |
| Molecular Weight | 451.08 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-7-(trifluoromethylamino)heptan-1-ol |
| SMILES | OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)NC(F)(F)F |
| InChI | InChI=1S/C8H2F17NO/c9-1(10,3(13,14)5(17,18)7(21,22)27)2(11,12)4(15,16)6(19,20)26-8(23,24)25/h26-27H |
| InChIKey | SHMZZVNMCBCPAX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.08 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|