C4H4F10O2 — CID 135382270
1,1,2,2,3,3,4,4-octafluorobutane-1,4-diol;dihydrofluoride (PubChem CID 135382270) has the molecular formula C4H4F10O2 and a molecular weight of 274.05 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluorobutane-1,4-diol;dihydrofluoride.
| Compound Name | 1,1,2,2,3,3,4,4-octafluorobutane-1,4-diol;dihydrofluoride |
|---|---|
| PubChem CID | 135382270 |
| Molecular Formula | C4H4F10O2 |
| Molecular Weight | 274.05 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluorobutane-1,4-diol;dihydrofluoride |
| SMILES | F.F.OC(F)(F)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C4H2F8O2.2FH/c5-1(6,3(9,10)13)2(7,8)4(11,12)14;;/h13-14H;2*1H |
| InChIKey | HLJAQTAUISTBDG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.05 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|