C4H3ClF6O — CID 142726898
4-chloro-1,1,2,2,3,3-hexafluorobutan-1-ol (PubChem CID 142726898) has the molecular formula C4H3ClF6O and a molecular weight of 216.51 g/mol. Its IUPAC name is 4-chloro-1,1,2,2,3,3-hexafluorobutan-1-ol.
| Compound Name | 4-chloro-1,1,2,2,3,3-hexafluorobutan-1-ol |
|---|---|
| PubChem CID | 142726898 |
| Molecular Formula | C4H3ClF6O |
| Molecular Weight | 216.51 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 4-chloro-1,1,2,2,3,3-hexafluorobutan-1-ol |
| SMILES | OC(F)(F)C(F)(F)C(F)(F)CCl |
| InChI | InChI=1S/C4H3ClF6O/c5-1-2(6,7)3(8,9)4(10,11)12/h12H,1H2 |
| InChIKey | JTPABXRVHVQDOT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|