C18H4Cl2F32O2 — CID 54564241
9-chloro-1-(9-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)peroxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane (PubChem CID 54564241) has the molecular formula C18H4Cl2F32O2 and a molecular weight of 931.07 g/mol. Its IUPAC name is 9-chloro-1-(9-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)peroxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane.
| Compound Name | 9-chloro-1-(9-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)peroxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane |
|---|---|
| PubChem CID | 54564241 |
| Molecular Formula | C18H4Cl2F32O2 |
| Molecular Weight | 931.07 g/mol |
| Exact Mass | 929.91 |
| IUPAC Name | 9-chloro-1-(9-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononyl)peroxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorononane |
| SMILES | FC(F)(CCl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCl |
| InChI | InChI=1S/C18H4Cl2F32O2/c19-1-3(21,22)5(25,26)7(29,30)9(33,34)11(37,38)13(41,42)15(45,46)17(49,50)53-54-18(51,52)16(47,48)14(43,44)12(39,40)10(35,36)8(31,32)6(27,28)4(23,24)2-20/h1-2H2 |
| InChIKey | ZSRVBVSGQUKYQW-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.07 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|