C12H4F20O4 — CID 21354878
6-(1,1,2,2,3,3,4,4,5,5-decafluoro-5-hydroxypentyl)peroxy-2,2,3,3,4,4,5,5,7,7-decafluorohept-6-en-1-ol (PubChem CID 21354878) has the molecular formula C12H4F20O4 and a molecular weight of 592.12 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5-decafluoro-5-hydroxypentyl)peroxy-2,2,3,3,4,4,5,5,7,7-decafluorohept-6-en-1-ol.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5-decafluoro-5-hydroxypentyl)peroxy-2,2,3,3,4,4,5,5,7,7-decafluorohept-6-en-1-ol |
|---|---|
| PubChem CID | 21354878 |
| Molecular Formula | C12H4F20O4 |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.98 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5-decafluoro-5-hydroxypentyl)peroxy-2,2,3,3,4,4,5,5,7,7-decafluorohept-6-en-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(OOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)(F)F)=C(F)F |
| InChI | InChI=1S/C12H4F20O4/c13-3(14)2(5(17,18)7(21,22)6(19,20)4(15,16)1-33)35-36-12(31,32)10(27,28)8(23,24)9(25,26)11(29,30)34/h33-34H,1H2 |
| InChIKey | XSGVBHUHJJTIHY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|