C10H2Cl2F16O3 — CID 87704915
(4-chloro-1,1,2,2,3,3-hexafluorobutyl) 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexaneperoxoate (PubChem CID 87704915) has the molecular formula C10H2Cl2F16O3 and a molecular weight of 545.00 g/mol. Its IUPAC name is (4-chloro-1,1,2,2,3,3-hexafluorobutyl) 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexaneperoxoate.
| Compound Name | (4-chloro-1,1,2,2,3,3-hexafluorobutyl) 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexaneperoxoate |
|---|---|
| PubChem CID | 87704915 |
| Molecular Formula | C10H2Cl2F16O3 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 543.91 |
| IUPAC Name | (4-chloro-1,1,2,2,3,3-hexafluorobutyl) 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexaneperoxoate |
| SMILES | O=C(OOC(F)(F)C(F)(F)C(F)(F)CCl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H2Cl2F16O3/c11-1-3(13,14)5(17,18)10(27,28)31-30-2(29)4(15,16)6(19,20)7(21,22)8(23,24)9(12,25)26/h1H2 |
| InChIKey | FXTKAYHVAHMRKD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|