C8H6ClF11O — CID 98454570
6-(2-chloroethoxy)-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane (PubChem CID 98454570) has the molecular formula C8H6ClF11O and a molecular weight of 362.57 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane.
| Compound Name | 6-(2-chloroethoxy)-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane |
|---|---|
| PubChem CID | 98454570 |
| Molecular Formula | C8H6ClF11O |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 6-(2-chloroethoxy)-1,1,1,2,2,3,3,4,4,5,5-undecafluorohexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCCl |
| InChI | InChI=1S/C8H6ClF11O/c9-1-2-21-3-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)20/h1-3H2 |
| InChIKey | OHUKFLHYNNTPHN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|