About 1,1,2-trichloroethanol
1,1,2-trichloroethanol (PubChem CID 176909401) has the molecular formula C4H6Cl6O2
and a molecular weight of 298.81 g/mol. Its IUPAC name is 1,1,2-trichloroethanol.
Molecular Properties
| Compound Name | 1,1,2-trichloroethanol |
| PubChem CID | 176909401 |
| Molecular Formula | C4H6Cl6O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 295.85 |
| IUPAC Name | 1,1,2-trichloroethanol |
| SMILES | OC(Cl)(Cl)CCl.OC(Cl)(Cl)CCl |
| InChI | InChI=1S/2C2H3Cl3O/c2*3-1-2(4,5)6/h2*6H,1H2 |
| InChIKey | XEDUJEBHBDVQNW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-trichloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trichloroethanol?
The IUPAC name of 1,1,2-trichloroethanol (CID 176909401) is 1,1,2-trichloroethanol.
What is the SMILES notation for 1,1,2-trichloroethanol?
The canonical SMILES for 1,1,2-trichloroethanol is OC(Cl)(Cl)CCl.OC(Cl)(Cl)CCl.
What is the InChIKey of 1,1,2-trichloroethanol?
The InChIKey is XEDUJEBHBDVQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H3Cl3O/c2*3-1-2(4,5)6/h2*6H,1H2.
What are the key properties of 1,1,2-trichloroethanol?
1,1,2-trichloroethanol has a molecular weight of 298.81 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trichloroethanol is sourced from PubChem (CID 176909401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).