C4H6Cl6O2 — CID 176909401
1,1,2-trichloroethanol (PubChem CID 176909401) has the molecular formula C4H6Cl6O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1,1,2-trichloroethanol.
| Compound Name | 1,1,2-trichloroethanol |
|---|---|
| PubChem CID | 176909401 |
| Molecular Formula | C4H6Cl6O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 295.85 |
| IUPAC Name | 1,1,2-trichloroethanol |
| SMILES | OC(Cl)(Cl)CCl.OC(Cl)(Cl)CCl |
| InChI | InChI=1S/2C2H3Cl3O/c2*3-1-2(4,5)6/h2*6H,1H2 |
| InChIKey | XEDUJEBHBDVQNW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|