C6H2F13NO — CID 54500305
N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hydroxylamine (PubChem CID 54500305) has the molecular formula C6H2F13NO and a molecular weight of 351.06 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hydroxylamine.
| Compound Name | N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hydroxylamine |
|---|---|
| PubChem CID | 54500305 |
| Molecular Formula | C6H2F13NO |
| Molecular Weight | 351.06 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)hydroxylamine |
| SMILES | ONC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F13NO/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20-21/h20-21H |
| InChIKey | YBYHDUBSIVGCKL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|