C10F22N2 — CID 139700095
bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)diazene (PubChem CID 139700095) has the molecular formula C10F22N2 and a molecular weight of 566.08 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)diazene.
| Compound Name | bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)diazene |
|---|---|
| PubChem CID | 139700095 |
| Molecular Formula | C10F22N2 |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.97 |
| IUPAC Name | bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)diazene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N=NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F22N2/c11-1(12,3(15,16)7(23,24)25)5(19,20)9(29,30)33-34-10(31,32)6(21,22)2(13,14)4(17,18)8(26,27)28 |
| InChIKey | YDECBFZJAUVGNC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|