C9H9F10NO2 — CID 153446280
1,1,2,2,3,3-hexafluoro-3-[(1,1,2,2-tetrafluoro-3-prop-2-enoxypropyl)amino]propan-1-ol (PubChem CID 153446280) has the molecular formula C9H9F10NO2 and a molecular weight of 353.16 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[(1,1,2,2-tetrafluoro-3-prop-2-enoxypropyl)amino]propan-1-ol.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[(1,1,2,2-tetrafluoro-3-prop-2-enoxypropyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 153446280 |
| Molecular Formula | C9H9F10NO2 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[(1,1,2,2-tetrafluoro-3-prop-2-enoxypropyl)amino]propan-1-ol |
| SMILES | C=CCOCC(F)(F)C(F)(F)NC(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C9H9F10NO2/c1-2-3-22-4-5(10,11)7(14,15)20-8(16,17)6(12,13)9(18,19)21/h2,20-21H,1,3-4H2 |
| InChIKey | ZFHUFRJXPSQRFI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|