C20H35FO6 — CID 125489573
1-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propane (PubChem CID 125489573) has the molecular formula C20H35FO6 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propane.
| Compound Name | 1-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propane |
|---|---|
| PubChem CID | 125489573 |
| Molecular Formula | C20H35FO6 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propane |
| SMILES | C=CCOCC(COCC=C)(COCC=C)COCCOCCOCCF |
| InChI | InChI=1S/C20H35FO6/c1-4-8-24-16-20(17-25-9-5-2,18-26-10-6-3)19-27-15-14-23-13-12-22-11-7-21/h4-6H,1-3,7-19H2 |
| InChIKey | BQDDWYYLHMZLTO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|