C35H71NO15 — CID 123473383
2-[2-[2-[2-[2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-prop-2-enoxypropoxy]ethoxy]ethoxy]ethoxy]-N-methylethanamine (PubChem CID 123473383) has the molecular formula C35H71NO15 and a molecular weight of 745.94 g/mol. Its IUPAC name is 2-[2-[2-[2-[2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-prop-2-enoxypropoxy]ethoxy]ethoxy]ethoxy]-N-methylethanamine.
| Compound Name | 2-[2-[2-[2-[2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-prop-2-enoxypropoxy]ethoxy]ethoxy]ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 123473383 |
| Molecular Formula | C35H71NO15 |
| Molecular Weight | 745.94 g/mol |
| Exact Mass | 745.48 |
| IUPAC Name | 2-[2-[2-[2-[2,2-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]-3-prop-2-enoxypropoxy]ethoxy]ethoxy]ethoxy]-N-methylethanamine |
| SMILES | C=CCOCC(COCCOCCOCCOCCNC)(COCCOCCOCCOCCOC)COCCOCCOCCOCCOC |
| InChI | InChI=1S/C35H71NO15/c1-5-7-48-31-35(32-49-28-25-45-22-19-42-14-13-39-8-6-36-2,33-50-29-26-46-23-20-43-17-15-40-11-9-37-3)34-51-30-27-47-24-21-44-18-16-41-12-10-38-4/h5,36H,1,6-34H2,2-4H3 |
| InChIKey | JAZFVANIXOWZJP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.94 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|