C10F18O3 — CID 141123570
1,3,3,4,4,4-hexafluoro-2-[1,3,3,4,4,4-hexafluoro-1-(trifluoromethoxy)but-1-en-2-yl]oxy-1-(trifluoromethoxy)but-1-ene (PubChem CID 141123570) has the molecular formula C10F18O3 and a molecular weight of 510.07 g/mol. Its IUPAC name is 1,3,3,4,4,4-hexafluoro-2-[1,3,3,4,4,4-hexafluoro-1-(trifluoromethoxy)but-1-en-2-yl]oxy-1-(trifluoromethoxy)but-1-ene.
| Compound Name | 1,3,3,4,4,4-hexafluoro-2-[1,3,3,4,4,4-hexafluoro-1-(trifluoromethoxy)but-1-en-2-yl]oxy-1-(trifluoromethoxy)but-1-ene |
|---|---|
| PubChem CID | 141123570 |
| Molecular Formula | C10F18O3 |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | 1,3,3,4,4,4-hexafluoro-2-[1,3,3,4,4,4-hexafluoro-1-(trifluoromethoxy)but-1-en-2-yl]oxy-1-(trifluoromethoxy)but-1-ene |
| SMILES | FC(OC(F)(F)F)=C(OC(=C(F)OC(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F18O3/c11-3(30-9(23,24)25)1(5(13,14)7(17,18)19)29-2(4(12)31-10(26,27)28)6(15,16)8(20,21)22 |
| InChIKey | AUQPGFGVSLRQQV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|