C10H5F7O — CID 58602117
1,1,3,3,4,4,4-heptafluorobut-1-en-2-yloxybenzene (PubChem CID 58602117) has the molecular formula C10H5F7O and a molecular weight of 274.13 g/mol. Its IUPAC name is 1,1,3,3,4,4,4-heptafluorobut-1-en-2-yloxybenzene.
| Compound Name | 1,1,3,3,4,4,4-heptafluorobut-1-en-2-yloxybenzene |
|---|---|
| PubChem CID | 58602117 |
| Molecular Formula | C10H5F7O |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1,1,3,3,4,4,4-heptafluorobut-1-en-2-yloxybenzene |
| SMILES | FC(F)=C(Oc1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F7O/c11-8(12)7(9(13,14)10(15,16)17)18-6-4-2-1-3-5-6/h1-5H |
| InChIKey | ICSWQMXOGWRSGS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|