C9H5F9N+ — CID 20802170
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-1-ium (PubChem CID 20802170) has the molecular formula C9H5F9N+ and a molecular weight of 298.13 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-1-ium.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-1-ium |
|---|---|
| PubChem CID | 20802170 |
| Molecular Formula | C9H5F9N+ |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-1-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[n+]1ccccc1 |
| InChI | InChI=1S/C9H5F9N/c10-6(11,8(14,15)16)7(12,13)9(17,18)19-4-2-1-3-5-19/h1-5H/q+1 |
| InChIKey | CRBTYINTZYQXEG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|