C13H9F13N+ — CID 87371946
1-ethyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyridin-1-ium (PubChem CID 87371946) has the molecular formula C13H9F13N+ and a molecular weight of 426.20 g/mol. Its IUPAC name is 1-ethyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyridin-1-ium.
| Compound Name | 1-ethyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyridin-1-ium |
|---|---|
| PubChem CID | 87371946 |
| Molecular Formula | C13H9F13N+ |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1-ethyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyridin-1-ium |
| SMILES | CC[n+]1ccccc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F13N/c1-2-27-6-4-3-5-7(27)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h3-6H,2H2,1H3/q+1 |
| InChIKey | RGNCJIIJCUVZES-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|