C9H10ClF4N — CID 42917288
1-ethyl-2-(1,2,2,2-tetrafluoroethyl)pyridin-1-ium chloride (PubChem CID 42917288) has the molecular formula C9H10ClF4N and a molecular weight of 243.63 g/mol. Its IUPAC name is 1-ethyl-2-(1,2,2,2-tetrafluoroethyl)pyridin-1-ium chloride.
| Compound Name | 1-ethyl-2-(1,2,2,2-tetrafluoroethyl)pyridin-1-ium chloride |
|---|---|
| PubChem CID | 42917288 |
| Molecular Formula | C9H10ClF4N |
| Molecular Weight | 243.63 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 1-ethyl-2-(1,2,2,2-tetrafluoroethyl)pyridin-1-ium chloride |
| SMILES | CC[n+]1ccccc1C(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C9H10F4N.ClH/c1-2-14-6-4-3-5-7(14)8(10)9(11,12)13;/h3-6,8H,2H2,1H3;1H/q+1;/p-1 |
| InChIKey | USXDEOYVGREJID-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.63 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|