C10H12F6N2O4S2 — CID 121235098
bis(trifluoromethylsulfonyl)azanide;1-ethyl-2-methylpyridin-1-ium (PubChem CID 121235098) has the molecular formula C10H12F6N2O4S2 and a molecular weight of 402.34 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-ethyl-2-methylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-ethyl-2-methylpyridin-1-ium |
|---|---|
| PubChem CID | 121235098 |
| Molecular Formula | C10H12F6N2O4S2 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-ethyl-2-methylpyridin-1-ium |
| SMILES | CC[n+]1ccccc1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12N.C2F6NO4S2/c1-3-9-7-5-4-6-8(9)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-7H,3H2,1-2H3;/q+1;-1 |
| InChIKey | XYCYJTAILPPEMP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|