C28H34N2O6S2+2 — CID 126959045
bis(4-methylbenzenesulfonic acid);2-methyl-1-[2-(2-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium (PubChem CID 126959045) has the molecular formula C28H34N2O6S2+2 and a molecular weight of 558.72 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonic acid);2-methyl-1-[2-(2-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium.
| Compound Name | bis(4-methylbenzenesulfonic acid);2-methyl-1-[2-(2-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 126959045 |
| Molecular Formula | C28H34N2O6S2+2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | bis(4-methylbenzenesulfonic acid);2-methyl-1-[2-(2-methylpyridin-1-ium-1-yl)ethyl]pyridin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.Cc1cccc[n+]1CC[n+]1ccccc1C |
| InChI | InChI=1S/C14H18N2.2C7H8O3S/c1-13-7-3-5-9-15(13)11-12-16-10-6-4-8-14(16)2;2*1-6-2-4-7(5-3-6)11(8,9)10/h3-10H,11-12H2,1-2H3;2*2-5H,1H3,(H,8,9,10)/q+2;; |
| InChIKey | YYHUVVJZSNMDRA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|