C12H22NO3S+ — CID 175583407
methanesulfonic acid;2-methyl-1-pentylpyridin-1-ium (PubChem CID 175583407) has the molecular formula C12H22NO3S+ and a molecular weight of 260.38 g/mol. Its IUPAC name is methanesulfonic acid;2-methyl-1-pentylpyridin-1-ium.
| Compound Name | methanesulfonic acid;2-methyl-1-pentylpyridin-1-ium |
|---|---|
| PubChem CID | 175583407 |
| Molecular Formula | C12H22NO3S+ |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methanesulfonic acid;2-methyl-1-pentylpyridin-1-ium |
| SMILES | CCCCC[n+]1ccccc1C.CS(=O)(=O)O |
| InChI | InChI=1S/C11H18N.CH4O3S/c1-3-4-6-9-12-10-7-5-8-11(12)2;1-5(2,3)4/h5,7-8,10H,3-4,6,9H2,1-2H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | JAHUHJVEZNKUTE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|