C29H46N2O2 — CID 175551422
1-hexadecyl-2-methylpyridin-1-ium;N-phenylcarbamate (PubChem CID 175551422) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is 1-hexadecyl-2-methylpyridin-1-ium;N-phenylcarbamate.
| Compound Name | 1-hexadecyl-2-methylpyridin-1-ium;N-phenylcarbamate |
|---|---|
| PubChem CID | 175551422 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | 1-hexadecyl-2-methylpyridin-1-ium;N-phenylcarbamate |
| SMILES | CCCCCCCCCCCCCCCC[n+]1ccccc1C.O=C([O-])Nc1ccccc1 |
| InChI | InChI=1S/C22H40N.C7H7NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23-21-18-16-19-22(23)2;9-7(10)8-6-4-2-1-3-5-6/h16,18-19,21H,3-15,17,20H2,1-2H3;1-5,8H,(H,9,10)/q+1;/p-1 |
| InChIKey | SWNKMYSQHRSTIG-UHFFFAOYSA-M |
| XLogP | 7.21 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|