C20H30N2+2 — CID 11455659
2-methyl-1-[8-(2-methylpyridin-1-ium-1-yl)octyl]pyridin-1-ium (PubChem CID 11455659) has the molecular formula C20H30N2+2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-methyl-1-[8-(2-methylpyridin-1-ium-1-yl)octyl]pyridin-1-ium.
| Compound Name | 2-methyl-1-[8-(2-methylpyridin-1-ium-1-yl)octyl]pyridin-1-ium |
|---|---|
| PubChem CID | 11455659 |
| Molecular Formula | C20H30N2+2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2-methyl-1-[8-(2-methylpyridin-1-ium-1-yl)octyl]pyridin-1-ium |
| SMILES | Cc1cccc[n+]1CCCCCCCC[n+]1ccccc1C |
| InChI | InChI=1S/C20H30N2/c1-19-13-7-11-17-21(19)15-9-5-3-4-6-10-16-22-18-12-8-14-20(22)2/h7-8,11-14,17-18H,3-6,9-10,15-16H2,1-2H3/q+2 |
| InChIKey | IAQVHTXFVJQBFB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|