C26H42N3O+ — CID 146551973
1,3-dioctyl-N-phenylimidazol-1-ium-2-carboxamide (PubChem CID 146551973) has the molecular formula C26H42N3O+ and a molecular weight of 412.64 g/mol. Its IUPAC name is 1,3-dioctyl-N-phenylimidazol-1-ium-2-carboxamide.
| Compound Name | 1,3-dioctyl-N-phenylimidazol-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 146551973 |
| Molecular Formula | C26H42N3O+ |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 1,3-dioctyl-N-phenylimidazol-1-ium-2-carboxamide |
| SMILES | CCCCCCCCn1cc[n+](CCCCCCCC)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H41N3O/c1-3-5-7-9-11-16-20-28-22-23-29(21-17-12-10-8-6-4-2)26(28)25(30)27-24-18-14-13-15-19-24/h13-15,18-19,22-23H,3-12,16-17,20-21H2,1-2H3/p+1 |
| InChIKey | QHXQKLAKJMIICF-UHFFFAOYSA-O |
| XLogP | 6.75 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|