C12H21N2O2+ — CID 58307877
1,3-dibutylimidazol-1-ium-2-carboxylic acid (PubChem CID 58307877) has the molecular formula C12H21N2O2+ and a molecular weight of 225.31 g/mol. Its IUPAC name is 1,3-dibutylimidazol-1-ium-2-carboxylic acid.
| Compound Name | 1,3-dibutylimidazol-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 58307877 |
| Molecular Formula | C12H21N2O2+ |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1,3-dibutylimidazol-1-ium-2-carboxylic acid |
| SMILES | CCCCn1cc[n+](CCCC)c1C(=O)O |
| InChI | InChI=1S/C12H20N2O2/c1-3-5-7-13-9-10-14(8-6-4-2)11(13)12(15)16/h9-10H,3-8H2,1-2H3/p+1 |
| InChIKey | CVXYZXQQPQOERC-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|