1,3-dibutylimidazol-1-ium-2-carboxylic acid

C12H21N2O2+ — CID 58307877

IUPAC1,3-dibutylimidazol-1-ium-2-carboxylic acid
SMILESCCCCn1cc[n+](CCCC)c1C(=O)O
InChIInChI=1S/C12H20N2O2/c1-3-5-7-13-9-10-14(8-6-4-2)11(13)12(15)16/h9-10H,3-8H2,1-2H3/p+1
InChIKeyCVXYZXQQPQOERC-UHFFFAOYSA-O
MW225.31 g/mol
LogP2.07
Rot. Bonds7

About 1,3-dibutylimidazol-1-ium-2-carboxylic acid

1,3-dibutylimidazol-1-ium-2-carboxylic acid (PubChem CID 58307877) has the molecular formula C12H21N2O2+ and a molecular weight of 225.31 g/mol. Its IUPAC name is 1,3-dibutylimidazol-1-ium-2-carboxylic acid.

Molecular Properties

Compound Name1,3-dibutylimidazol-1-ium-2-carboxylic acid
PubChem CID58307877
Molecular FormulaC12H21N2O2+
Molecular Weight225.31 g/mol
Exact Mass225.16
IUPAC Name1,3-dibutylimidazol-1-ium-2-carboxylic acid
SMILESCCCCn1cc[n+](CCCC)c1C(=O)O
InChIInChI=1S/C12H20N2O2/c1-3-5-7-13-9-10-14(8-6-4-2)11(13)12(15)16/h9-10H,3-8H2,1-2H3/p+1
InChIKeyCVXYZXQQPQOERC-UHFFFAOYSA-O
XLogP2.07
TPSA46.11 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.31
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1,3-dibutylimidazol-1-ium-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dibutylimidazol-1-ium-2-carboxylic acid?
The IUPAC name of 1,3-dibutylimidazol-1-ium-2-carboxylic acid (CID 58307877) is 1,3-dibutylimidazol-1-ium-2-carboxylic acid.
What is the SMILES notation for 1,3-dibutylimidazol-1-ium-2-carboxylic acid?
The canonical SMILES for 1,3-dibutylimidazol-1-ium-2-carboxylic acid is CCCCn1cc[n+](CCCC)c1C(=O)O.
What is the InChIKey of 1,3-dibutylimidazol-1-ium-2-carboxylic acid?
The InChIKey is CVXYZXQQPQOERC-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H20N2O2/c1-3-5-7-13-9-10-14(8-6-4-2)11(13)12(15)16/h9-10H,3-8H2,1-2H3/p+1.
What are the key properties of 1,3-dibutylimidazol-1-ium-2-carboxylic acid?
1,3-dibutylimidazol-1-ium-2-carboxylic acid has a molecular weight of 225.31 g/mol, XLogP of 2.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutylimidazol-1-ium-2-carboxylic acid is sourced from PubChem (CID 58307877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).