C15H29N2+ — CID 87809363
1,2,3-tributylimidazol-1-ium (PubChem CID 87809363) has the molecular formula C15H29N2+ and a molecular weight of 237.41 g/mol. Its IUPAC name is 1,2,3-tributylimidazol-1-ium.
| Compound Name | 1,2,3-tributylimidazol-1-ium |
|---|---|
| PubChem CID | 87809363 |
| Molecular Formula | C15H29N2+ |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | 1,2,3-tributylimidazol-1-ium |
| SMILES | CCCCc1n(CCCC)cc[n+]1CCCC |
| InChI | InChI=1S/C15H29N2/c1-4-7-10-15-16(11-8-5-2)13-14-17(15)12-9-6-3/h13-14H,4-12H2,1-3H3/q+1 |
| InChIKey | KATPRLQFEJPNQU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|