1,3-dihexylimidazol-1-ium-2-carboxylic acid

C16H29N2O2+ — CID 142550559

IUPAC1,3-dihexylimidazol-1-ium-2-carboxylic acid
SMILESCCCCCCn1cc[n+](CCCCCC)c1C(=O)O
InChIInChI=1S/C16H28N2O2/c1-3-5-7-9-11-17-13-14-18(15(17)16(19)20)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/p+1
InChIKeyMMLGJZOBJJVGQB-UHFFFAOYSA-O
MW281.42 g/mol
LogP3.63
Rot. Bonds11

About 1,3-dihexylimidazol-1-ium-2-carboxylic acid

1,3-dihexylimidazol-1-ium-2-carboxylic acid (PubChem CID 142550559) has the molecular formula C16H29N2O2+ and a molecular weight of 281.42 g/mol. Its IUPAC name is 1,3-dihexylimidazol-1-ium-2-carboxylic acid.

Molecular Properties

Compound Name1,3-dihexylimidazol-1-ium-2-carboxylic acid
PubChem CID142550559
Molecular FormulaC16H29N2O2+
Molecular Weight281.42 g/mol
Exact Mass281.22
IUPAC Name1,3-dihexylimidazol-1-ium-2-carboxylic acid
SMILESCCCCCCn1cc[n+](CCCCCC)c1C(=O)O
InChIInChI=1S/C16H28N2O2/c1-3-5-7-9-11-17-13-14-18(15(17)16(19)20)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/p+1
InChIKeyMMLGJZOBJJVGQB-UHFFFAOYSA-O
XLogP3.63
TPSA46.11 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds11
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.42
LogP ≤ 53.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1,3-dihexylimidazol-1-ium-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dihexylimidazol-1-ium-2-carboxylic acid?
The IUPAC name of 1,3-dihexylimidazol-1-ium-2-carboxylic acid (CID 142550559) is 1,3-dihexylimidazol-1-ium-2-carboxylic acid.
What is the SMILES notation for 1,3-dihexylimidazol-1-ium-2-carboxylic acid?
The canonical SMILES for 1,3-dihexylimidazol-1-ium-2-carboxylic acid is CCCCCCn1cc[n+](CCCCCC)c1C(=O)O.
What is the InChIKey of 1,3-dihexylimidazol-1-ium-2-carboxylic acid?
The InChIKey is MMLGJZOBJJVGQB-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H28N2O2/c1-3-5-7-9-11-17-13-14-18(15(17)16(19)20)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/p+1.
What are the key properties of 1,3-dihexylimidazol-1-ium-2-carboxylic acid?
1,3-dihexylimidazol-1-ium-2-carboxylic acid has a molecular weight of 281.42 g/mol, XLogP of 3.63, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihexylimidazol-1-ium-2-carboxylic acid is sourced from PubChem (CID 142550559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).