C16H29N2O2+ — CID 142550559
1,3-dihexylimidazol-1-ium-2-carboxylic acid (PubChem CID 142550559) has the molecular formula C16H29N2O2+ and a molecular weight of 281.42 g/mol. Its IUPAC name is 1,3-dihexylimidazol-1-ium-2-carboxylic acid.
| Compound Name | 1,3-dihexylimidazol-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 142550559 |
| Molecular Formula | C16H29N2O2+ |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 1,3-dihexylimidazol-1-ium-2-carboxylic acid |
| SMILES | CCCCCCn1cc[n+](CCCCCC)c1C(=O)O |
| InChI | InChI=1S/C16H28N2O2/c1-3-5-7-9-11-17-13-14-18(15(17)16(19)20)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/p+1 |
| InChIKey | MMLGJZOBJJVGQB-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 46.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|