C9H10F4N+ — CID 2308707
1-ethyl-2-[(1S)-1,2,2,2-tetrafluoroethyl]pyridin-1-ium (PubChem CID 2308707) has the molecular formula C9H10F4N+ and a molecular weight of 208.18 g/mol. Its IUPAC name is 1-ethyl-2-[(1S)-1,2,2,2-tetrafluoroethyl]pyridin-1-ium.
| Compound Name | 1-ethyl-2-[(1S)-1,2,2,2-tetrafluoroethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 2308707 |
| Molecular Formula | C9H10F4N+ |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-ethyl-2-[(1S)-1,2,2,2-tetrafluoroethyl]pyridin-1-ium |
| SMILES | CC[n+]1ccccc1[C@H](F)C(F)(F)F |
| InChI | InChI=1S/C9H10F4N/c1-2-14-6-4-3-5-7(14)8(10)9(11,12)13/h3-6,8H,2H2,1H3/q+1/t8-/m0/s1 |
| InChIKey | VSVMHXFMQBOQEC-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|