C16H6F15N — CID 12507587
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)isoquinoline (PubChem CID 12507587) has the molecular formula C16H6F15N and a molecular weight of 497.20 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)isoquinoline.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)isoquinoline |
|---|---|
| PubChem CID | 12507587 |
| Molecular Formula | C16H6F15N |
| Molecular Weight | 497.20 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)isoquinoline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1nccc2ccccc12 |
| InChI | InChI=1S/C16H6F15N/c17-10(18,9-8-4-2-1-3-7(8)5-6-32-9)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-6H |
| InChIKey | XWKPAJFGQGHCIZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.20 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|