C17H22N2O — CID 135329525
2-ethyl-2-isoquinolin-1-yl-3,3-dimethylbutanamide (PubChem CID 135329525) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-ethyl-2-isoquinolin-1-yl-3,3-dimethylbutanamide.
| Compound Name | 2-ethyl-2-isoquinolin-1-yl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 135329525 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-ethyl-2-isoquinolin-1-yl-3,3-dimethylbutanamide |
| SMILES | CCC(C(N)=O)(c1nccc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C17H22N2O/c1-5-17(15(18)20,16(2,3)4)14-13-9-7-6-8-12(13)10-11-19-14/h6-11H,5H2,1-4H3,(H2,18,20) |
| InChIKey | BSRLNGPIUOUQMG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |