C15H20N2O — CID 174754953
2,2-dimethylbutanamide;quinoline (PubChem CID 174754953) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,2-dimethylbutanamide;quinoline.
| Compound Name | 2,2-dimethylbutanamide;quinoline |
|---|---|
| PubChem CID | 174754953 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,2-dimethylbutanamide;quinoline |
| SMILES | CCC(C)(C)C(N)=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H13NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-4-6(2,3)5(7)8/h1-7H;4H2,1-3H3,(H2,7,8) |
| InChIKey | QVSUWNLIEABSSU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |