About 2,2-dimethylbutanamide;quinoline
2,2-dimethylbutanamide;quinoline (PubChem CID 174754953) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,2-dimethylbutanamide;quinoline.
Molecular Properties
| Compound Name | 2,2-dimethylbutanamide;quinoline |
| PubChem CID | 174754953 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,2-dimethylbutanamide;quinoline |
| SMILES | CCC(C)(C)C(N)=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H13NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-4-6(2,3)5(7)8/h1-7H;4H2,1-3H3,(H2,7,8) |
| InChIKey | QVSUWNLIEABSSU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylbutanamide;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutanamide;quinoline?
The IUPAC name of 2,2-dimethylbutanamide;quinoline (CID 174754953) is 2,2-dimethylbutanamide;quinoline.
What is the SMILES notation for 2,2-dimethylbutanamide;quinoline?
The canonical SMILES for 2,2-dimethylbutanamide;quinoline is CCC(C)(C)C(N)=O.c1ccc2ncccc2c1.
What is the InChIKey of 2,2-dimethylbutanamide;quinoline?
The InChIKey is QVSUWNLIEABSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H13NO/c1-2-6-9-8(4-1)5-3-7-10-9;1-4-6(2,3)5(7)8/h1-7H;4H2,1-3H3,(H2,7,8).
What are the key properties of 2,2-dimethylbutanamide;quinoline?
2,2-dimethylbutanamide;quinoline has a molecular weight of 244.34 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutanamide;quinoline is sourced from PubChem (CID 174754953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).