C20H27NO2 — CID 158551998
quinoline;2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 158551998) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is quinoline;2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | quinoline;2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 158551998 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | quinoline;2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C11H20O2.C9H7N/c1-10(2,3)8(12)7-9(13)11(4,5)6;1-2-6-9-8(4-1)5-3-7-10-9/h7H2,1-6H3;1-7H |
| InChIKey | HPVJYJWEJRYVKV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|