C26H11F17N2 — CID 102266958
5-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]-1,10-phenanthroline (PubChem CID 102266958) has the molecular formula C26H11F17N2 and a molecular weight of 674.35 g/mol. Its IUPAC name is 5-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102266958 |
| Molecular Formula | C26H11F17N2 |
| Molecular Weight | 674.35 g/mol |
| Exact Mass | 674.07 |
| IUPAC Name | 5-[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]-1,10-phenanthroline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(-c2cc3cccnc3c3ncccc23)cc1 |
| InChI | InChI=1S/C26H11F17N2/c27-19(28,20(29,30)21(31,32)22(33,34)23(35,36)24(37,38)25(39,40)26(41,42)43)14-7-5-12(6-8-14)16-11-13-3-1-9-44-17(13)18-15(16)4-2-10-45-18/h1-11H |
| InChIKey | HXMLEZHTGQZASU-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.35 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|