C25H20N4 — CID 139516694
5-[4-(2,5,6-trimethylpyrimidin-4-yl)phenyl]-1,10-phenanthroline (PubChem CID 139516694) has the molecular formula C25H20N4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-[4-(2,5,6-trimethylpyrimidin-4-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-(2,5,6-trimethylpyrimidin-4-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 139516694 |
| Molecular Formula | C25H20N4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-[4-(2,5,6-trimethylpyrimidin-4-yl)phenyl]-1,10-phenanthroline |
| SMILES | Cc1nc(C)c(C)c(-c2ccc(-c3cc4cccnc4c4ncccc34)cc2)n1 |
| InChI | InChI=1S/C25H20N4/c1-15-16(2)28-17(3)29-23(15)19-10-8-18(9-11-19)22-14-20-6-4-12-26-24(20)25-21(22)7-5-13-27-25/h4-14H,1-3H3 |
| InChIKey | XOPZEYNDLDATJQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|