C17H9F17O2 — CID 19089422
[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] propanoate (PubChem CID 19089422) has the molecular formula C17H9F17O2 and a molecular weight of 568.22 g/mol. Its IUPAC name is [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] propanoate.
| Compound Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] propanoate |
|---|---|
| PubChem CID | 19089422 |
| Molecular Formula | C17H9F17O2 |
| Molecular Weight | 568.22 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H9F17O2/c1-2-9(35)36-8-6-4-3-5-7(8)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h3-6H,2H2,1H3 |
| InChIKey | UCRWNLWENBOIDT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.22 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|