C21H14F24N2O6S — CID 87830182
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-N,N-bis(2-hydroxyethyl)pyridin-1-ium-4-carboxamide;trifluoromethanesulfonate (PubChem CID 87830182) has the molecular formula C21H14F24N2O6S and a molecular weight of 878.37 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-N,N-bis(2-hydroxyethyl)pyridin-1-ium-4-carboxamide;trifluoromethanesulfonate.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-N,N-bis(2-hydroxyethyl)pyridin-1-ium-4-carboxamide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87830182 |
| Molecular Formula | C21H14F24N2O6S |
| Molecular Weight | 878.37 g/mol |
| Exact Mass | 878.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-N,N-bis(2-hydroxyethyl)pyridin-1-ium-4-carboxamide;trifluoromethanesulfonate |
| SMILES | O=C(c1cc[n+](C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)N(CCO)CCO.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H14F21N2O3.CHF3O3S/c21-11(22,13(25,26)15(29,30)17(33,34)19(37,38)39)12(23,24)14(27,28)16(31,32)18(35,36)20(40,41)43-3-1-9(2-4-43)10(46)42(5-7-44)6-8-45;2-1(3,4)8(5,6)7/h1-4,44-45H,5-8H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JFOLCNLGPQBVGB-UHFFFAOYSA-M |
| XLogP | 5.65 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|