C13H20N2O5S — CID 60655214
4-(dimethylsulfamoyl)-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 60655214) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 60655214 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C13H20N2O5S/c1-14(2)21(19,20)12-5-3-11(4-6-12)13(18)15(7-9-16)8-10-17/h3-6,16-17H,7-10H2,1-2H3 |
| InChIKey | NHRHKTHMMFEGSL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |