C13H19NO4 — CID 61235842
N,N-bis(2-hydroxyethyl)-4-(methoxymethyl)benzamide (PubChem CID 61235842) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-(methoxymethyl)benzamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 61235842 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-(methoxymethyl)benzamide |
| SMILES | COCc1ccc(C(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C13H19NO4/c1-18-10-11-2-4-12(5-3-11)13(17)14(6-8-15)7-9-16/h2-5,15-16H,6-10H2,1H3 |
| InChIKey | VSEXWZQFKQRLIF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |