C12H15F2NO4 — CID 60653738
4-(difluoromethoxy)-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 60653738) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 60653738 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 4-(difluoromethoxy)-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | O=C(c1ccc(OC(F)F)cc1)N(CCO)CCO |
| InChI | InChI=1S/C12H15F2NO4/c13-12(14)19-10-3-1-9(2-4-10)11(18)15(5-7-16)6-8-17/h1-4,12,16-17H,5-8H2 |
| InChIKey | KWENRPNDYHOVHC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |