C18H11F21NO+ — CID 87827286
3-[1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)pyridin-1-ium-4-yl]propan-1-ol (PubChem CID 87827286) has the molecular formula C18H11F21NO+ and a molecular weight of 656.25 g/mol. Its IUPAC name is 3-[1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)pyridin-1-ium-4-yl]propan-1-ol.
| Compound Name | 3-[1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)pyridin-1-ium-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 87827286 |
| Molecular Formula | C18H11F21NO+ |
| Molecular Weight | 656.25 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | 3-[1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)pyridin-1-ium-4-yl]propan-1-ol |
| SMILES | OCCCc1cc[n+](C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F21NO/c19-9(20,11(23,24)13(27,28)15(31,32)17(35,36)37)10(21,22)12(25,26)14(29,30)16(33,34)18(38,39)40-5-3-8(4-6-40)2-1-7-41/h3-6,41H,1-2,7H2/q+1 |
| InChIKey | VOZDDTPPGGLTMX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.25 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|