C13H14F9NO4S — CID 158900423
3-[1-(1,1,2,4,4,4-hexafluorobutyl)pyridin-1-ium-4-yl]propan-1-ol;trifluoromethanesulfonate (PubChem CID 158900423) has the molecular formula C13H14F9NO4S and a molecular weight of 451.31 g/mol. Its IUPAC name is 3-[1-(1,1,2,4,4,4-hexafluorobutyl)pyridin-1-ium-4-yl]propan-1-ol;trifluoromethanesulfonate.
| Compound Name | 3-[1-(1,1,2,4,4,4-hexafluorobutyl)pyridin-1-ium-4-yl]propan-1-ol;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158900423 |
| Molecular Formula | C13H14F9NO4S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 3-[1-(1,1,2,4,4,4-hexafluorobutyl)pyridin-1-ium-4-yl]propan-1-ol;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.OCCCc1cc[n+](C(F)(F)C(F)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F6NO.CHF3O3S/c13-10(8-11(14,15)16)12(17,18)19-5-3-9(4-6-19)2-1-7-20;2-1(3,4)8(5,6)7/h3-6,10,20H,1-2,7-8H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JFJHFZLVNXFNQV-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|