C20H20F3IO4S — CID 10962570
[3-(2-hydroxyethyl)-5-phenylpent-1-ynyl]-phenyliodanium;trifluoromethanesulfonate (PubChem CID 10962570) has the molecular formula C20H20F3IO4S and a molecular weight of 540.34 g/mol. Its IUPAC name is [3-(2-hydroxyethyl)-5-phenylpent-1-ynyl]-phenyliodanium;trifluoromethanesulfonate.
| Compound Name | [3-(2-hydroxyethyl)-5-phenylpent-1-ynyl]-phenyliodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10962570 |
| Molecular Formula | C20H20F3IO4S |
| Molecular Weight | 540.34 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | [3-(2-hydroxyethyl)-5-phenylpent-1-ynyl]-phenyliodanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.OCCC(C#C[I+]c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H20IO.CHF3O3S/c21-16-14-18(12-11-17-7-3-1-4-8-17)13-15-20-19-9-5-2-6-10-19;2-1(3,4)8(5,6)7/h1-10,18,21H,11-12,14,16H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FZGRNNUOKPGZIU-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|