C18H14F3IO2 — CID 71725565
phenyl(4-phenylbut-1-ynyl)iodanium;2,2,2-trifluoroacetate (PubChem CID 71725565) has the molecular formula C18H14F3IO2 and a molecular weight of 446.21 g/mol. Its IUPAC name is phenyl(4-phenylbut-1-ynyl)iodanium;2,2,2-trifluoroacetate.
| Compound Name | phenyl(4-phenylbut-1-ynyl)iodanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71725565 |
| Molecular Formula | C18H14F3IO2 |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | phenyl(4-phenylbut-1-ynyl)iodanium;2,2,2-trifluoroacetate |
| SMILES | C(#C[I+]c1ccccc1)CCc1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H14I.C2HF3O2/c1-3-9-15(10-4-1)11-7-8-14-17-16-12-5-2-6-13-16;3-2(4,5)1(6)7/h1-6,9-10,12-13H,7,11H2;(H,6,7)/q+1;/p-1 |
| InChIKey | WBUGBNYJOUGYFF-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|