C27H27F3N2O2 — CID 141106250
(4S,5R)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 141106250) has the molecular formula C27H27F3N2O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is (4S,5R)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | (4S,5R)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141106250 |
| Molecular Formula | C27H27F3N2O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (4S,5R)-4,5-diphenyl-2-(4-phenylbutyl)-4,5-dihydro-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1ccc(CCCCC2=N[C@@H](c3ccccc3)[C@@H](c3ccccc3)[NH2+]2)cc1 |
| InChI | InChI=1S/C25H26N2.C2HF3O2/c1-4-12-20(13-5-1)14-10-11-19-23-26-24(21-15-6-2-7-16-21)25(27-23)22-17-8-3-9-18-22;3-2(4,5)1(6)7/h1-9,12-13,15-18,24-25H,10-11,14,19H2,(H,26,27);(H,6,7)/t24-,25+; |
| InChIKey | AJNCOKJKBAYLPR-GMFOKBBGSA-N |
| XLogP | 4.16 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|