C13H18F3NO3 — CID 158032331
3-(4-hydroxyphenyl)propyl-dimethylazanium;2,2,2-trifluoroacetate (PubChem CID 158032331) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)propyl-dimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 3-(4-hydroxyphenyl)propyl-dimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 158032331 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-(4-hydroxyphenyl)propyl-dimethylazanium;2,2,2-trifluoroacetate |
| SMILES | C[NH+](C)CCCc1ccc(O)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H17NO.C2HF3O2/c1-12(2)9-3-4-10-5-7-11(13)8-6-10;3-2(4,5)1(6)7/h5-8,13H,3-4,9H2,1-2H3;(H,6,7) |
| InChIKey | FHIDSJCJENXTHG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |