About 4-(3-fluoropropyl)phenol
4-(3-fluoropropyl)phenol (PubChem CID 68765958) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 4-(3-fluoropropyl)phenol.
Molecular Properties
| Compound Name | 4-(3-fluoropropyl)phenol |
| PubChem CID | 68765958 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 4-(3-fluoropropyl)phenol |
| SMILES | Oc1ccc(CCCF)cc1 |
| InChI | InChI=1S/C9H11FO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2,7H2 |
| InChIKey | QQDHFTDEZLHQFX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-fluoropropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoropropyl)phenol?
The IUPAC name of 4-(3-fluoropropyl)phenol (CID 68765958) is 4-(3-fluoropropyl)phenol.
What is the SMILES notation for 4-(3-fluoropropyl)phenol?
The canonical SMILES for 4-(3-fluoropropyl)phenol is Oc1ccc(CCCF)cc1.
What is the InChIKey of 4-(3-fluoropropyl)phenol?
The InChIKey is QQDHFTDEZLHQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2,7H2.
What are the key properties of 4-(3-fluoropropyl)phenol?
4-(3-fluoropropyl)phenol has a molecular weight of 154.18 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoropropyl)phenol is sourced from PubChem (CID 68765958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).