About 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate
2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate (PubChem CID 71725870) has the molecular formula C16H9BrF3IO2
and a molecular weight of 497.05 g/mol. Its IUPAC name is 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate |
| PubChem CID | 71725870 |
| Molecular Formula | C16H9BrF3IO2 |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 495.88 |
| IUPAC Name | 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate |
| SMILES | Brc1ccc(C#C[I+]c2ccccc2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H9BrI.C2HF3O2/c15-13-8-6-12(7-9-13)10-11-16-14-4-2-1-3-5-14;3-2(4,5)1(6)7/h1-9H;(H,6,7)/q+1;/p-1 |
| InChIKey | VXTLSCIQNWABBR-UHFFFAOYSA-M |
| XLogP | 0.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate?
The IUPAC name of 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate (CID 71725870) is 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate.
What is the SMILES notation for 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate?
The canonical SMILES for 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate is Brc1ccc(C#C[I+]c2ccccc2)cc1.O=C([O-])C(F)(F)F.
What is the InChIKey of 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate?
The InChIKey is VXTLSCIQNWABBR-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H9BrI.C2HF3O2/c15-13-8-6-12(7-9-13)10-11-16-14-4-2-1-3-5-14;3-2(4,5)1(6)7/h1-9H;(H,6,7)/q+1;/p-1.
What are the key properties of 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate?
2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate has a molecular weight of 497.05 g/mol, XLogP of 0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)ethynyl-phenyliodanium;2,2,2-trifluoroacetate is sourced from PubChem (CID 71725870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).